C10H9Cl2NO2 — CID 98058305
(2S)-2,4-dichloro-3-oxo-N-phenylbutanamide (PubChem CID 98058305) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is (2S)-2,4-dichloro-3-oxo-N-phenylbutanamide.
| Compound Name | (2S)-2,4-dichloro-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 98058305 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | (2S)-2,4-dichloro-3-oxo-N-phenylbutanamide |
| SMILES | O=C(CCl)[C@H](Cl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H9Cl2NO2/c11-6-8(14)9(12)10(15)13-7-4-2-1-3-5-7/h1-5,9H,6H2,(H,13,15)/t9-/m0/s1 |
| InChIKey | JASVZHHUORWQKB-VIFPVBQESA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|