C16H13Cl2NO2 — CID 57282831
N-(4-benzoylphenyl)-2,3-dichloropropanamide (PubChem CID 57282831) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-2,3-dichloropropanamide.
| Compound Name | N-(4-benzoylphenyl)-2,3-dichloropropanamide |
|---|---|
| PubChem CID | 57282831 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-(4-benzoylphenyl)-2,3-dichloropropanamide |
| SMILES | O=C(c1ccccc1)c1ccc(NC(=O)C(Cl)CCl)cc1 |
| InChI | InChI=1S/C16H13Cl2NO2/c17-10-14(18)16(21)19-13-8-6-12(7-9-13)15(20)11-4-2-1-3-5-11/h1-9,14H,10H2,(H,19,21) |
| InChIKey | MEXRRLTXVIVTBM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|