C22H16Cl4N2O2 — CID 69077883
2-chloro-2-[(2-chlorophenyl)methylamino]-N-[4-(3,4-dichlorobenzoyl)phenyl]acetamide (PubChem CID 69077883) has the molecular formula C22H16Cl4N2O2 and a molecular weight of 482.19 g/mol. Its IUPAC name is 2-chloro-2-[(2-chlorophenyl)methylamino]-N-[4-(3,4-dichlorobenzoyl)phenyl]acetamide.
| Compound Name | 2-chloro-2-[(2-chlorophenyl)methylamino]-N-[4-(3,4-dichlorobenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 69077883 |
| Molecular Formula | C22H16Cl4N2O2 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 2-chloro-2-[(2-chlorophenyl)methylamino]-N-[4-(3,4-dichlorobenzoyl)phenyl]acetamide |
| SMILES | O=C(c1ccc(NC(=O)C(Cl)NCc2ccccc2Cl)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl4N2O2/c23-17-4-2-1-3-15(17)12-27-21(26)22(30)28-16-8-5-13(6-9-16)20(29)14-7-10-18(24)19(25)11-14/h1-11,21,27H,12H2,(H,28,30) |
| InChIKey | QJOZYGAOWFSXQY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|