C20H24N2O3 — CID 125463843
N-(4-benzoylphenyl)-2-[[(2R)-1-hydroxypentan-2-yl]amino]acetamide (PubChem CID 125463843) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-2-[[(2R)-1-hydroxypentan-2-yl]amino]acetamide.
| Compound Name | N-(4-benzoylphenyl)-2-[[(2R)-1-hydroxypentan-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 125463843 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-(4-benzoylphenyl)-2-[[(2R)-1-hydroxypentan-2-yl]amino]acetamide |
| SMILES | CCC[C@H](CO)NCC(=O)Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-6-18(14-23)21-13-19(24)22-17-11-9-16(10-12-17)20(25)15-7-4-3-5-8-15/h3-5,7-12,18,21,23H,2,6,13-14H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | TUMBNJAPUGWEOZ-GOSISDBHSA-N |
| XLogP | 2.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |