C27H24ClN5O5S — CID 98059898
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98059898) has the molecular formula C27H24ClN5O5S and a molecular weight of 566.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98059898 |
| Molecular Formula | C27H24ClN5O5S |
| Molecular Weight | 566.04 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CN(c2ccc([N+](=O)[O-])cc2)S(=O)(=O)c2ccccc2)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H24ClN5O5S/c1-19-15-21(20(2)32(19)25-8-6-7-22(28)16-25)17-29-30-27(34)18-31(23-11-13-24(14-12-23)33(35)36)39(37,38)26-9-4-3-5-10-26/h3-17H,18H2,1-2H3,(H,30,34)/b29-17- |
| InChIKey | GTSAADRELIALPH-RHANQZHGSA-N |
| XLogP | 5.00 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|