C20H21NO5 — CID 98070471
(3aS,4S,7S,7aS)-2-(5-acetyl-2-ethoxyphenyl)-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98070471) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (3aS,4S,7S,7aS)-2-(5-acetyl-2-ethoxyphenyl)-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4S,7S,7aS)-2-(5-acetyl-2-ethoxyphenyl)-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98070471 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (3aS,4S,7S,7aS)-2-(5-acetyl-2-ethoxyphenyl)-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCOc1ccc(C(C)=O)cc1N1C(=O)[C@H]2[C@H](C1=O)[C@]1(C)C=C[C@]2(C)O1 |
| InChI | InChI=1S/C20H21NO5/c1-5-25-14-7-6-12(11(2)22)10-13(14)21-17(23)15-16(18(21)24)20(4)9-8-19(15,3)26-20/h6-10,15-16H,5H2,1-4H3/t15-,16-,19+,20+/m1/s1 |
| InChIKey | DMZFHWXMPCRDFN-YKCBXCCJSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|