C25H22FN3O5 — CID 98072707
ethyl 4-[(3S,3'aR,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]benzoate (PubChem CID 98072707) has the molecular formula C25H22FN3O5 and a molecular weight of 463.47 g/mol. Its IUPAC name is ethyl 4-[(3S,3'aR,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]benzoate.
| Compound Name | ethyl 4-[(3S,3'aR,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]benzoate |
|---|---|
| PubChem CID | 98072707 |
| Molecular Formula | C25H22FN3O5 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | ethyl 4-[(3S,3'aR,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@]2(C(=O)Nc4ccc(F)cc42)N2CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C25H22FN3O5/c1-2-34-23(32)13-5-8-15(9-6-13)29-21(30)19-18-4-3-11-28(18)25(20(19)22(29)31)16-12-14(26)7-10-17(16)27-24(25)33/h5-10,12,18-20H,2-4,11H2,1H3,(H,27,33)/t18-,19+,20-,25+/m0/s1 |
| InChIKey | KUIZFCYTWLYTDP-PBQROFAYSA-N |
| XLogP | 2.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|