C24H22FN3O5S — CID 124788720
methyl 2-[(3R,3'aS,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 124788720) has the molecular formula C24H22FN3O5S and a molecular weight of 483.52 g/mol. Its IUPAC name is methyl 2-[(3R,3'aS,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3R,3'aS,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 124788720 |
| Molecular Formula | C24H22FN3O5S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | methyl 2-[(3R,3'aS,8'aS,8'bS)-5-fluoro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@@H]3[C@@H]4CCCN4[C@]4(C(=O)Nc5ccc(F)cc54)[C@H]3C2=O)sc(C)c1C |
| InChI | InChI=1S/C24H22FN3O5S/c1-10-11(2)34-21(16(10)22(31)33-3)28-19(29)17-15-5-4-8-27(15)24(18(17)20(28)30)13-9-12(25)6-7-14(13)26-23(24)32/h6-7,9,15,17-18H,4-5,8H2,1-3H3,(H,26,32)/t15-,17+,18+,24-/m0/s1 |
| InChIKey | DWCTXZDSNYNDLN-MDXXILDGSA-N |
| XLogP | 2.72 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|