C5H7NO2 — CID 98073935
(1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one (PubChem CID 98073935) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is (1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 98073935 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (1R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| SMILES | O=C1O[C@H]2CN[C@H]1C2 |
| InChI | InChI=1S/C5H7NO2/c7-5-4-1-3(8-5)2-6-4/h3-4,6H,1-2H2/t3-,4+/m1/s1 |
| InChIKey | WAWSGFGXFSUXIA-DMTCNVIQSA-N |
| XLogP | -0.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |