C23H33NO3 — CID 98079939
2-[(3S,5S)-3,5-dimethyl-1-adamantyl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide (PubChem CID 98079939) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 2-[(3S,5S)-3,5-dimethyl-1-adamantyl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[(3S,5S)-3,5-dimethyl-1-adamantyl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 98079939 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-[(3S,5S)-3,5-dimethyl-1-adamantyl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1cccc(OCCNC(=O)CC23CC4C[C@](C)(C2)C[C@](C)(C4)C3)c1 |
| InChI | InChI=1S/C23H33NO3/c1-21-10-17-11-22(2,14-21)16-23(12-17,15-21)13-20(25)24-7-8-27-19-6-4-5-18(9-19)26-3/h4-6,9,17H,7-8,10-16H2,1-3H3,(H,24,25)/t17?,21-,22-,23?/m0/s1 |
| InChIKey | UGJGIKFXVGAJHU-YCVWAYHFSA-N |
| XLogP | 4.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|