C20H28N4S2 — CID 98082855
1-N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-N-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]piperazine-1,4-dicarbothioamide (PubChem CID 98082855) has the molecular formula C20H28N4S2 and a molecular weight of 388.61 g/mol. Its IUPAC name is 1-N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-N-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]piperazine-1,4-dicarbothioamide.
| Compound Name | 1-N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-N-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 98082855 |
| Molecular Formula | C20H28N4S2 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-4-N-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]piperazine-1,4-dicarbothioamide |
| SMILES | S=C(N[C@H]1C[C@@H]2C=C[C@H]1C2)N1CCN(C(=S)N[C@@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C20H28N4S2/c25-19(21-17-11-13-1-3-15(17)9-13)23-5-7-24(8-6-23)20(26)22-18-12-14-2-4-16(18)10-14/h1-4,13-18H,5-12H2,(H,21,25)(H,22,26)/t13-,14+,15-,16-,17+,18-/m0/s1 |
| InChIKey | MKEZAFBVCFNWSB-MULDDASSSA-N |
| XLogP | 2.28 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|