C5H6N2O2 — CID 98084355
(1R,6R)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (PubChem CID 98084355) has the molecular formula C5H6N2O2 and a molecular weight of 126.11 g/mol. Its IUPAC name is (1R,6R)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
| Compound Name | (1R,6R)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
|---|---|
| PubChem CID | 98084355 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | (1R,6R)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| SMILES | O=C1NNC(=O)[C@@H]2C[C@@H]12 |
| InChI | InChI=1S/C5H6N2O2/c8-4-2-1-3(2)5(9)7-6-4/h2-3H,1H2,(H,6,8)(H,7,9)/t2-,3-/m1/s1 |
| InChIKey | JUDZQAANDBTZIQ-PWNYCUMCSA-N |
| XLogP | -1.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |