C7H11NO — CID 98084456
(2R)-2-ethenyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 98084456) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (2R)-2-ethenyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | (2R)-2-ethenyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 98084456 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2R)-2-ethenyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | C=C[C@H]1CCCC=[N+]1[O-] |
| InChI | InChI=1S/C7H11NO/c1-2-7-5-3-4-6-8(7)9/h2,6-7H,1,3-5H2/t7-/m0/s1 |
| InChIKey | ZHQYSYNQGFCLPE-ZETCQYMHSA-N |
| XLogP | 1.31 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|