C8H13NO — CID 131163058
2-ethenyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 131163058) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-ethenyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | 2-ethenyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 131163058 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-ethenyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | C=CC1CCCC(C)=[N+]1[O-] |
| InChI | InChI=1S/C8H13NO/c1-3-8-6-4-5-7(2)9(8)10/h3,8H,1,4-6H2,2H3 |
| InChIKey | AWTAYOGNPDNWDP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|