C11H18INO — CID 11404025
2-(iodomethyl)-1-oxido-6-pent-4-enyl-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 11404025) has the molecular formula C11H18INO and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-(iodomethyl)-1-oxido-6-pent-4-enyl-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | 2-(iodomethyl)-1-oxido-6-pent-4-enyl-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 11404025 |
| Molecular Formula | C11H18INO |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-(iodomethyl)-1-oxido-6-pent-4-enyl-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | C=CCCCC1=[N+]([O-])C(CI)CCC1 |
| InChI | InChI=1S/C11H18INO/c1-2-3-4-6-10-7-5-8-11(9-12)13(10)14/h2,11H,1,3-9H2 |
| InChIKey | HZMLZAPTCFIKSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|