C11H19NO — CID 10997653
2-but-3-enyl-7-methyl-1-oxido-3,4,5,6-tetrahydro-2H-azepin-1-ium (PubChem CID 10997653) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-but-3-enyl-7-methyl-1-oxido-3,4,5,6-tetrahydro-2H-azepin-1-ium.
| Compound Name | 2-but-3-enyl-7-methyl-1-oxido-3,4,5,6-tetrahydro-2H-azepin-1-ium |
|---|---|
| PubChem CID | 10997653 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-but-3-enyl-7-methyl-1-oxido-3,4,5,6-tetrahydro-2H-azepin-1-ium |
| SMILES | C=CCCC1CCCCC(C)=[N+]1[O-] |
| InChI | InChI=1S/C11H19NO/c1-3-4-8-11-9-6-5-7-10(2)12(11)13/h3,11H,1,4-9H2,2H3 |
| InChIKey | ZBQHIEGWIDHWLB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|