C16H29N — CID 15722664
2-methyl-5-undec-10-enyl-3,4-dihydro-2H-pyrrole (PubChem CID 15722664) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 2-methyl-5-undec-10-enyl-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-methyl-5-undec-10-enyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 15722664 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2-methyl-5-undec-10-enyl-3,4-dihydro-2H-pyrrole |
| SMILES | C=CCCCCCCCCCC1=NC(C)CC1 |
| InChI | InChI=1S/C16H29N/c1-3-4-5-6-7-8-9-10-11-12-16-14-13-15(2)17-16/h3,15H,1,4-14H2,2H3 |
| InChIKey | YYGBXYNPLXELNL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|