C10H17NO — CID 14808042
2-but-3-enyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 14808042) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-but-3-enyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | 2-but-3-enyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 14808042 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-but-3-enyl-6-methyl-1-oxido-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | C=CCCC1CCCC(C)=[N+]1[O-] |
| InChI | InChI=1S/C10H17NO/c1-3-4-7-10-8-5-6-9(2)11(10)12/h3,10H,1,4-8H2,2H3 |
| InChIKey | YHTCTQRPHNQMHF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|