C17H22N2O — CID 98086099
(1S,4R)-3,3-dimethyl-2-methylidene-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98086099) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (1S,4R)-3,3-dimethyl-2-methylidene-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4R)-3,3-dimethyl-2-methylidene-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98086099 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (1S,4R)-3,3-dimethyl-2-methylidene-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@]1(C(=O)NCc1ccccn1)C2 |
| InChI | InChI=1S/C17H22N2O/c1-12-16(2,3)13-7-8-17(12,10-13)15(20)19-11-14-6-4-5-9-18-14/h4-6,9,13H,1,7-8,10-11H2,2-3H3,(H,19,20)/t13-,17+/m1/s1 |
| InChIKey | UAEYQRVYZONRCN-DYVFJYSZSA-N |
| XLogP | 3.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|