C18H22N2O2 — CID 135956704
(1R,4R)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 135956704) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1R,4R)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4R)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 135956704 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (1R,4R)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@@]1(C(=O)N/N=C/c1ccccc1O)C2 |
| InChI | InChI=1S/C18H22N2O2/c1-12-17(2,3)14-8-9-18(12,10-14)16(22)20-19-11-13-6-4-5-7-15(13)21/h4-7,11,14,21H,1,8-10H2,2-3H3,(H,20,22)/b19-11+/t14-,18-/m1/s1 |
| InChIKey | SFGRYJPIYZKPJI-WLNRYVJDSA-N |
| XLogP | 3.22 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|