C18H22N2O3 — CID 135798591
(1R,4R)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 135798591) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1R,4R)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4R)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 135798591 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (1R,4R)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@@]1(C(=O)N/N=C\c1ccc(O)c(O)c1)C2 |
| InChI | InChI=1S/C18H22N2O3/c1-11-17(2,3)13-6-7-18(11,9-13)16(23)20-19-10-12-4-5-14(21)15(22)8-12/h4-5,8,10,13,21-22H,1,6-7,9H2,2-3H3,(H,20,23)/b19-10-/t13-,18-/m1/s1 |
| InChIKey | CSDRVEKUFJFQPS-CAFKOEIJSA-N |
| XLogP | 2.93 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|