C23H27N3O3 — CID 137064415
(1S)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-1-methylspiro[2,4-dihydroisoquinoline-3,1'-cyclohexane]-1-carboxamide (PubChem CID 137064415) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (1S)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-1-methylspiro[2,4-dihydroisoquinoline-3,1'-cyclohexane]-1-carboxamide.
| Compound Name | (1S)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-1-methylspiro[2,4-dihydroisoquinoline-3,1'-cyclohexane]-1-carboxamide |
|---|---|
| PubChem CID | 137064415 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (1S)-N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-1-methylspiro[2,4-dihydroisoquinoline-3,1'-cyclohexane]-1-carboxamide |
| SMILES | C[C@]1(C(=O)N/N=C\c2ccc(O)c(O)c2)NC2(CCCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C23H27N3O3/c1-22(21(29)25-24-15-16-9-10-19(27)20(28)13-16)18-8-4-3-7-17(18)14-23(26-22)11-5-2-6-12-23/h3-4,7-10,13,15,26-28H,2,5-6,11-12,14H2,1H3,(H,25,29)/b24-15-/t22-/m0/s1 |
| InChIKey | MEEZFFVDDDBOIX-IOOSODASSA-N |
| XLogP | 3.31 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|