C23H23N3O4 — CID 135680018
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide (PubChem CID 135680018) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide |
|---|---|
| PubChem CID | 135680018 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide |
| SMILES | O=C(CC1=NC2(CCCC2)Cc2ccccc21)C(=O)N/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H23N3O4/c27-19-8-7-15(11-20(19)28)14-24-26-22(30)21(29)12-18-17-6-2-1-5-16(17)13-23(25-18)9-3-4-10-23/h1-2,5-8,11,14,27-28H,3-4,9-10,12-13H2,(H,26,30)/b24-14+ |
| InChIKey | ROQYKIMPTOKMFY-ZVHZXABRSA-N |
| XLogP | 2.87 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|