C23H22N4O4 — CID 7460948
N-[(Z)-(3-nitrophenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide (PubChem CID 7460948) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[(Z)-(3-nitrophenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide.
| Compound Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide |
|---|---|
| PubChem CID | 7460948 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-2-oxo-3-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpropanamide |
| SMILES | O=C(CC1=NC2(CCCC2)Cc2ccccc21)C(=O)N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N4O4/c28-21(22(29)26-24-15-16-6-5-8-18(12-16)27(30)31)13-20-19-9-2-1-7-17(19)14-23(25-20)10-3-4-11-23/h1-2,5-9,12,15H,3-4,10-11,13-14H2,(H,26,29)/b24-15- |
| InChIKey | CRPJIHKMVWUISA-IWIPYMOSSA-N |
| XLogP | 3.36 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|