C15H14N4O4 — CID 172964476
N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-N-(6-methyl-2-pyridinyl)oxamide (PubChem CID 172964476) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-N-(6-methyl-2-pyridinyl)oxamide.
| Compound Name | N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-N-(6-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 172964476 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-N-(6-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)N/N=C/c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C15H14N4O4/c1-9-3-2-4-13(17-9)18-14(22)15(23)19-16-8-10-5-6-11(20)12(21)7-10/h2-8,20-21H,1H3,(H,19,23)(H,17,18,22)/b16-8+ |
| InChIKey | LXAFNBRRMUONJZ-LZYBPNLTSA-N |
| XLogP | 0.89 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|