C17H16BrN3O3 — CID 135821347
N'-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)oxamide (PubChem CID 135821347) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is N'-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)oxamide.
| Compound Name | N'-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 135821347 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | N'-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C/c2ccc(O)c(Br)c2)cc1C |
| InChI | InChI=1S/C17H16BrN3O3/c1-10-3-5-13(7-11(10)2)20-16(23)17(24)21-19-9-12-4-6-15(22)14(18)8-12/h3-9,22H,1-2H3,(H,20,23)(H,21,24)/b19-9+ |
| InChIKey | RTUCTMLULOMJBB-DJKKODMXSA-N |
| XLogP | 2.86 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|