C15H15N3O3 — CID 108522685
N'-(2-hydroxy-5-methylphenyl)-N-(6-methyl-2-pyridinyl)oxamide (PubChem CID 108522685) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is N'-(2-hydroxy-5-methylphenyl)-N-(6-methyl-2-pyridinyl)oxamide.
| Compound Name | N'-(2-hydroxy-5-methylphenyl)-N-(6-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108522685 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N'-(2-hydroxy-5-methylphenyl)-N-(6-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccc(O)c(NC(=O)C(=O)Nc2cccc(C)n2)c1 |
| InChI | InChI=1S/C15H15N3O3/c1-9-6-7-12(19)11(8-9)17-14(20)15(21)18-13-5-3-4-10(2)16-13/h3-8,19H,1-2H3,(H,17,20)(H,16,18,21) |
| InChIKey | JVAMXZCCADNNGO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|