C16H18ClF3N2O5 — CID 98087509
methyl (2R)-2-[4-[[(Z)-(1-chloro-2-methylpropylidene)amino]oxycarbonyl-methylamino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 98087509) has the molecular formula C16H18ClF3N2O5 and a molecular weight of 410.78 g/mol. Its IUPAC name is methyl (2R)-2-[4-[[(Z)-(1-chloro-2-methylpropylidene)amino]oxycarbonyl-methylamino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[4-[[(Z)-(1-chloro-2-methylpropylidene)amino]oxycarbonyl-methylamino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 98087509 |
| Molecular Formula | C16H18ClF3N2O5 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | methyl (2R)-2-[4-[[(Z)-(1-chloro-2-methylpropylidene)amino]oxycarbonyl-methylamino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | COC(=O)[C@](O)(c1ccc(N(C)C(=O)O/N=C(\Cl)C(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H18ClF3N2O5/c1-9(2)12(17)21-27-14(24)22(3)11-7-5-10(6-8-11)15(25,13(23)26-4)16(18,19)20/h5-9,25H,1-4H3/b21-12-/t15-/m1/s1 |
| InChIKey | IXBAHNVSUHQTRB-OFNOZLENSA-N |
| XLogP | 3.39 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|