C30H35N7O3 — CID 98090745
2-azido-N-[(2R)-1-(cyclohexylamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-6-phenylpyrimidine-4-carboxamide (PubChem CID 98090745) has the molecular formula C30H35N7O3 and a molecular weight of 541.66 g/mol. Its IUPAC name is 2-azido-N-[(2R)-1-(cyclohexylamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-6-phenylpyrimidine-4-carboxamide.
| Compound Name | 2-azido-N-[(2R)-1-(cyclohexylamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-6-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 98090745 |
| Molecular Formula | C30H35N7O3 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 2-azido-N-[(2R)-1-(cyclohexylamino)-4-methyl-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-6-phenylpyrimidine-4-carboxamide |
| SMILES | COc1ccc(N(C(=O)c2cc(-c3ccccc3)nc(N=[N+]=[N-])n2)[C@H](CC(C)C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C30H35N7O3/c1-20(2)18-27(28(38)32-22-12-8-5-9-13-22)37(23-14-16-24(40-3)17-15-23)29(39)26-19-25(21-10-6-4-7-11-21)33-30(34-26)35-36-31/h4,6-7,10-11,14-17,19-20,22,27H,5,8-9,12-13,18H2,1-3H3,(H,32,38)/t27-/m1/s1 |
| InChIKey | VCNCDDNRLYAUPK-HHHXNRCGSA-N |
| XLogP | 6.60 |
| TPSA | 133.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|