C8H15ClO6 — CID 98091406
(2S,3S,4S,5S)-2-(2-chloroethoxy)-2-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 98091406) has the molecular formula C8H15ClO6 and a molecular weight of 242.65 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-(2-chloroethoxy)-2-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S)-2-(2-chloroethoxy)-2-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 98091406 |
| Molecular Formula | C8H15ClO6 |
| Molecular Weight | 242.65 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2S,3S,4S,5S)-2-(2-chloroethoxy)-2-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@]1(OCCCl)OC[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H15ClO6/c9-1-2-14-8(4-10)7(13)6(12)5(11)3-15-8/h5-7,10-13H,1-4H2/t5-,6-,7-,8+/m0/s1 |
| InChIKey | UNKSWTOXDXZLNE-DKXJUACHSA-N |
| XLogP | -1.96 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.65 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|