C24H24BrN5O2S — CID 98092858
N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]sulfanyl]acetamide (PubChem CID 98092858) has the molecular formula C24H24BrN5O2S and a molecular weight of 526.46 g/mol. Its IUPAC name is N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 98092858 |
| Molecular Formula | C24H24BrN5O2S |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | N-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]sulfanyl]acetamide |
| SMILES | COCc1cc(C)nc(SCC(=O)N/N=C\c2cc(C)n(-c3ccc(Br)cc3)c2C)c1C#N |
| InChI | InChI=1S/C24H24BrN5O2S/c1-15-9-19(13-32-4)22(11-26)24(28-15)33-14-23(31)29-27-12-18-10-16(2)30(17(18)3)21-7-5-20(25)6-8-21/h5-10,12H,13-14H2,1-4H3,(H,29,31)/b27-12- |
| InChIKey | PVLNTTOVGGIZAI-PPDIBHTLSA-N |
| XLogP | 4.82 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|