C31H30ClN3O5S — CID 98093167
4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzamide (PubChem CID 98093167) has the molecular formula C31H30ClN3O5S and a molecular weight of 592.12 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 98093167 |
| Molecular Formula | C31H30ClN3O5S |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccc(CN(c3cccc(Cl)c3C)S(=O)(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C31H30ClN3O5S/c1-21-27(32)11-8-12-28(21)35(41(37,38)26-9-6-5-7-10-26)20-23-13-15-24(16-14-23)31(36)34-33-22(2)25-17-18-29(39-3)30(19-25)40-4/h5-19H,20H2,1-4H3,(H,34,36)/b33-22- |
| InChIKey | XGWFVMVVKAJYRU-NVMPUMLXSA-N |
| XLogP | 6.22 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|