C28H23ClFN3O3S — CID 98056542
4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide (PubChem CID 98056542) has the molecular formula C28H23ClFN3O3S and a molecular weight of 536.03 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 98056542 |
| Molecular Formula | C28H23ClFN3O3S |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)-3-chloro-2-methylanilino]methyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide |
| SMILES | Cc1c(Cl)cccc1N(Cc1ccc(C(=O)N/N=C\c2ccccc2F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23ClFN3O3S/c1-20-25(29)11-7-13-27(20)33(37(35,36)24-9-3-2-4-10-24)19-21-14-16-22(17-15-21)28(34)32-31-18-23-8-5-6-12-26(23)30/h2-18H,19H2,1H3,(H,32,34)/b31-18- |
| InChIKey | MGHMGVZEWQSUKC-MNBJERMJSA-N |
| XLogP | 5.95 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|