C13H9F3N2O4 — CID 98095443
(5S)-5-acetyl-1-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 98095443) has the molecular formula C13H9F3N2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is (5S)-5-acetyl-1-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-acetyl-1-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 98095443 |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (5S)-5-acetyl-1-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)[C@H]1C(=O)NC(=O)N(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C13H9F3N2O4/c1-6(19)9-10(20)17-12(22)18(11(9)21)8-5-3-2-4-7(8)13(14,15)16/h2-5,9H,1H3,(H,17,20,22)/t9-/m0/s1 |
| InChIKey | JSWSIRDOJYIJJZ-VIFPVBQESA-N |
| XLogP | 1.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|