C12H11F3N2O3 — CID 106110759
5-methoxy-3-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 106110759) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 5-methoxy-3-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-methoxy-3-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 106110759 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-methoxy-3-[2-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | COC1CNC(=O)N(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H11F3N2O3/c1-20-9-6-16-11(19)17(10(9)18)8-5-3-2-4-7(8)12(13,14)15/h2-5,9H,6H2,1H3,(H,16,19) |
| InChIKey | QRGGPYCWBLYNGC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |