(R)-morpholine-4-sulfinyl fluoride

C4H8FNO2S — CID 98095773

IUPAC(R)-morpholine-4-sulfinyl fluoride
SMILESO=[S@](F)N1CCOCC1
InChIInChI=1S/C4H8FNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2/t9-/m1/s1
InChIKeyDTUAZNHESLXOHI-SECBINFHSA-N
MW153.18 g/mol
LogP-0.13
Rot. Bonds1

About (R)-morpholine-4-sulfinyl fluoride

(R)-morpholine-4-sulfinyl fluoride (PubChem CID 98095773) has the molecular formula C4H8FNO2S and a molecular weight of 153.18 g/mol. Its IUPAC name is (R)-morpholine-4-sulfinyl fluoride.

Molecular Properties

Compound Name(R)-morpholine-4-sulfinyl fluoride
PubChem CID98095773
Molecular FormulaC4H8FNO2S
Molecular Weight153.18 g/mol
Exact Mass153.03
IUPAC Name(R)-morpholine-4-sulfinyl fluoride
SMILESO=[S@](F)N1CCOCC1
InChIInChI=1S/C4H8FNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2/t9-/m1/s1
InChIKeyDTUAZNHESLXOHI-SECBINFHSA-N
XLogP-0.13
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.18
LogP ≤ 5-0.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (R)-morpholine-4-sulfinyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (R)-morpholine-4-sulfinyl fluoride?
The IUPAC name of (R)-morpholine-4-sulfinyl fluoride (CID 98095773) is (R)-morpholine-4-sulfinyl fluoride.
What is the SMILES notation for (R)-morpholine-4-sulfinyl fluoride?
The canonical SMILES for (R)-morpholine-4-sulfinyl fluoride is O=[S@](F)N1CCOCC1.
What is the InChIKey of (R)-morpholine-4-sulfinyl fluoride?
The InChIKey is DTUAZNHESLXOHI-SECBINFHSA-N. The full InChI is InChI=1S/C4H8FNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2/t9-/m1/s1.
What are the key properties of (R)-morpholine-4-sulfinyl fluoride?
(R)-morpholine-4-sulfinyl fluoride has a molecular weight of 153.18 g/mol, XLogP of -0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-morpholine-4-sulfinyl fluoride is sourced from PubChem (CID 98095773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).