C12H12FNO2 — CID 98108371
(3S)-1-ethyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 98108371) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is (3S)-1-ethyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-ethyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98108371 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (3S)-1-ethyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)C[C@@H](c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C12H12FNO2/c1-2-14-11(15)7-10(12(14)16)8-4-3-5-9(13)6-8/h3-6,10H,2,7H2,1H3/t10-/m0/s1 |
| InChIKey | ZUWFBBIMPISIPM-JTQLQIEISA-N |
| XLogP | 1.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|