C18H16FNO3 — CID 98176099
(3R)-3-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 98176099) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is (3R)-3-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98176099 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (3R)-3-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C[C@H](c3cccc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H16FNO3/c1-23-15-7-5-12(6-8-15)11-20-17(21)10-16(18(20)22)13-3-2-4-14(19)9-13/h2-9,16H,10-11H2,1H3/t16-/m1/s1 |
| InChIKey | PWBFSTVOPQKIKF-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|