C28H30N4O4 — CID 98110909
(1S,2S,5R,6S,7S)-2-N-cyclohexyl-4-oxo-6-N-phenyl-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98110909) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is (1S,2S,5R,6S,7S)-2-N-cyclohexyl-4-oxo-6-N-phenyl-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6S,7S)-2-N-cyclohexyl-4-oxo-6-N-phenyl-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98110909 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (1S,2S,5R,6S,7S)-2-N-cyclohexyl-4-oxo-6-N-phenyl-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1[C@@H]2C=C[C@]3(O2)[C@@H]1C(=O)N(Cc1cccnc1)[C@@H]3C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H30N4O4/c33-25(30-19-9-3-1-4-10-19)22-21-13-14-28(36-21)23(22)27(35)32(17-18-8-7-15-29-16-18)24(28)26(34)31-20-11-5-2-6-12-20/h1,3-4,7-10,13-16,20-24H,2,5-6,11-12,17H2,(H,30,33)(H,31,34)/t21-,22+,23-,24+,28-/m0/s1 |
| InChIKey | BHXYDEVEZPKUAB-NOBOBNKPSA-N |
| XLogP | 2.82 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|