C9H17NO2 — CID 98111483
(2S,4R)-2,4-dihydroxy-3,3,5-trimethylhexanenitrile (PubChem CID 98111483) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (2S,4R)-2,4-dihydroxy-3,3,5-trimethylhexanenitrile.
| Compound Name | (2S,4R)-2,4-dihydroxy-3,3,5-trimethylhexanenitrile |
|---|---|
| PubChem CID | 98111483 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (2S,4R)-2,4-dihydroxy-3,3,5-trimethylhexanenitrile |
| SMILES | CC(C)[C@@H](O)C(C)(C)[C@H](O)C#N |
| InChI | InChI=1S/C9H17NO2/c1-6(2)8(12)9(3,4)7(11)5-10/h6-8,11-12H,1-4H3/t7-,8-/m1/s1 |
| InChIKey | QRIVFPKZTKGPJA-HTQZYQBOSA-N |
| XLogP | 0.91 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|