C13H28O3 — CID 175140928
2,2,5,5,7-pentamethyloctane-1,4,6-triol (PubChem CID 175140928) has the molecular formula C13H28O3 and a molecular weight of 232.36 g/mol. Its IUPAC name is 2,2,5,5,7-pentamethyloctane-1,4,6-triol.
| Compound Name | 2,2,5,5,7-pentamethyloctane-1,4,6-triol |
|---|---|
| PubChem CID | 175140928 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 2,2,5,5,7-pentamethyloctane-1,4,6-triol |
| SMILES | CC(C)C(O)C(C)(C)C(O)CC(C)(C)CO |
| InChI | InChI=1S/C13H28O3/c1-9(2)11(16)13(5,6)10(15)7-12(3,4)8-14/h9-11,14-16H,7-8H2,1-6H3 |
| InChIKey | FVSDEQKMRIXTPX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |