C17H27NO4 — CID 98114397
(1S,2R,3S,4S)-3-[[(1S,5R)-3,3,5-trimethylcyclohexyl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 98114397) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[[(1S,5R)-3,3,5-trimethylcyclohexyl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S)-3-[[(1S,5R)-3,3,5-trimethylcyclohexyl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98114397 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (1S,2R,3S,4S)-3-[[(1S,5R)-3,3,5-trimethylcyclohexyl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | C[C@H]1C[C@H](NC(=O)[C@H]2[C@@H](C(=O)O)[C@@H]3CC[C@@H]2O3)CC(C)(C)C1 |
| InChI | InChI=1S/C17H27NO4/c1-9-6-10(8-17(2,3)7-9)18-15(19)13-11-4-5-12(22-11)14(13)16(20)21/h9-14H,4-8H2,1-3H3,(H,18,19)(H,20,21)/t9-,10-,11-,12-,13+,14-/m0/s1 |
| InChIKey | GDYZQHMAUYZCAF-VZKILSJISA-N |
| XLogP | 2.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |