C12H13F3N2O2 — CID 98117569
ethyl (E)-3-amino-3-[4-(trifluoromethyl)anilino]prop-2-enoate (PubChem CID 98117569) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is ethyl (E)-3-amino-3-[4-(trifluoromethyl)anilino]prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-3-[4-(trifluoromethyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 98117569 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | ethyl (E)-3-amino-3-[4-(trifluoromethyl)anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\N)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-2-19-11(18)7-10(16)17-9-5-3-8(4-6-9)12(13,14)15/h3-7,17H,2,16H2,1H3/b10-7+ |
| InChIKey | QFDFCRLLDSIVSG-JXMROGBWSA-N |
| XLogP | 2.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|