About [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine
[(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine (PubChem CID 98119965) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine.
Analyze [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine?
The IUPAC name of [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine (CID 98119965) is [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine.
What is the SMILES notation for [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine?
The canonical SMILES for [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine is NC[C@@H]1NC[C@H]2C[C@@H]21.
What is the InChIKey of [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine?
The InChIKey is TUIHCOLESXTWCL-SRQIZXRXSA-N. The full InChI is InChI=1S/C6H12N2/c7-2-6-5-1-4(5)3-8-6/h4-6,8H,1-3,7H2/t4-,5+,6+/m1/s1.
What are the key properties of [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine?
[(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine has a molecular weight of 112.18 g/mol, XLogP of -0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine is sourced from PubChem (CID 98119965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).