C6H9NO — CID 89128835
(1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carbaldehyde (PubChem CID 89128835) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carbaldehyde.
| Compound Name | (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carbaldehyde |
|---|---|
| PubChem CID | 89128835 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carbaldehyde |
| SMILES | O=C[C@H]1NC[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C6H9NO/c8-3-6-5-1-4(5)2-7-6/h3-7H,1-2H2/t4-,5-,6+/m0/s1 |
| InChIKey | BWOYSPXVDHBNLR-HCWXCVPCSA-N |
| XLogP | -0.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|