C7H12N2O — CID 170446091
(4R)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[2,3-c]pyrrole-4-carbaldehyde (PubChem CID 170446091) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (4R)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[2,3-c]pyrrole-4-carbaldehyde.
| Compound Name | (4R)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[2,3-c]pyrrole-4-carbaldehyde |
|---|---|
| PubChem CID | 170446091 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (4R)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[2,3-c]pyrrole-4-carbaldehyde |
| SMILES | O=C[C@@H]1NCC2NCCC21 |
| InChI | InChI=1S/C7H12N2O/c10-4-7-5-1-2-8-6(5)3-9-7/h4-9H,1-3H2/t5?,6?,7-/m0/s1 |
| InChIKey | QKIQAYSZXSFDJN-AHXFUIDQSA-N |
| XLogP | -0.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|