C6H11ClO3S — CID 98123735
cis-(1S,2R)-2-hydroxycyclohexane-1-sulfonyl chloride (PubChem CID 98123735) has the molecular formula C6H11ClO3S and a molecular weight of 198.67 g/mol. Its IUPAC name is cis-(1S,2R)-2-hydroxycyclohexane-1-sulfonyl chloride.
| Compound Name | cis-(1S,2R)-2-hydroxycyclohexane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 98123735 |
| Molecular Formula | C6H11ClO3S |
| Molecular Weight | 198.67 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | cis-(1S,2R)-2-hydroxycyclohexane-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C6H11ClO3S/c7-11(9,10)6-4-2-1-3-5(6)8/h5-6,8H,1-4H2/t5-,6+/m1/s1 |
| InChIKey | HPXWZMBYQSLXBP-RITPCOANSA-N |
| XLogP | 0.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |