C30H28N4O4S — CID 98123917
N-[(Z)-1-(3-benzamidophenyl)ethylideneamino]-2-[benzyl(methylsulfonyl)amino]benzamide (PubChem CID 98123917) has the molecular formula C30H28N4O4S and a molecular weight of 540.65 g/mol. Its IUPAC name is N-[(Z)-1-(3-benzamidophenyl)ethylideneamino]-2-[benzyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(Z)-1-(3-benzamidophenyl)ethylideneamino]-2-[benzyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 98123917 |
| Molecular Formula | C30H28N4O4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-[(Z)-1-(3-benzamidophenyl)ethylideneamino]-2-[benzyl(methylsulfonyl)amino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccccc1N(Cc1ccccc1)S(C)(=O)=O)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H28N4O4S/c1-22(25-16-11-17-26(20-25)31-29(35)24-14-7-4-8-15-24)32-33-30(36)27-18-9-10-19-28(27)34(39(2,37)38)21-23-12-5-3-6-13-23/h3-20H,21H2,1-2H3,(H,31,35)(H,33,36)/b32-22- |
| InChIKey | YYGQCZQMIFIERT-JDCMOKTRSA-N |
| XLogP | 5.06 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|