C28H24IN3O3S — CID 43878893
2-[benzenesulfonyl(benzyl)amino]-N-[(E)-1-(3-iodophenyl)ethylideneamino]benzamide (PubChem CID 43878893) has the molecular formula C28H24IN3O3S and a molecular weight of 609.49 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[(E)-1-(3-iodophenyl)ethylideneamino]benzamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(E)-1-(3-iodophenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 43878893 |
| Molecular Formula | C28H24IN3O3S |
| Molecular Weight | 609.49 g/mol |
| Exact Mass | 609.06 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(E)-1-(3-iodophenyl)ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1N(Cc1ccccc1)S(=O)(=O)c1ccccc1)c1cccc(I)c1 |
| InChI | InChI=1S/C28H24IN3O3S/c1-21(23-13-10-14-24(29)19-23)30-31-28(33)26-17-8-9-18-27(26)32(20-22-11-4-2-5-12-22)36(34,35)25-15-6-3-7-16-25/h2-19H,20H2,1H3,(H,31,33)/b30-21+ |
| InChIKey | RUODFZUJSMEISI-MWAVMZGNSA-N |
| XLogP | 5.84 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|