C27H33N3O3 — CID 98126365
2-[4-[[[3-(2-methoxyethoxy)phenyl]methylamino]methyl]cyclohexyl]quinoline-4-carboxamide (PubChem CID 98126365) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[4-[[[3-(2-methoxyethoxy)phenyl]methylamino]methyl]cyclohexyl]quinoline-4-carboxamide.
| Compound Name | 2-[4-[[[3-(2-methoxyethoxy)phenyl]methylamino]methyl]cyclohexyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 98126365 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-[4-[[[3-(2-methoxyethoxy)phenyl]methylamino]methyl]cyclohexyl]quinoline-4-carboxamide |
| SMILES | COCCOc1cccc(CNCC2CCC(c3cc(C(N)=O)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C27H33N3O3/c1-32-13-14-33-22-6-4-5-20(15-22)18-29-17-19-9-11-21(12-10-19)26-16-24(27(28)31)23-7-2-3-8-25(23)30-26/h2-8,15-16,19,21,29H,9-14,17-18H2,1H3,(H2,28,31) |
| InChIKey | GFALESGGTMRRHE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|